C24H29F3N2 — CID 143517254
1-but-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]piperazine;prop-2-enylbenzene (PubChem CID 143517254) has the molecular formula C24H29F3N2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-but-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]piperazine;prop-2-enylbenzene.
| Compound Name | 1-but-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]piperazine;prop-2-enylbenzene |
|---|---|
| PubChem CID | 143517254 |
| Molecular Formula | C24H29F3N2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-but-1-en-2-yl-4-[2-(trifluoromethyl)phenyl]piperazine;prop-2-enylbenzene |
| SMILES | C=C(CC)N1CCN(c2ccccc2C(F)(F)F)CC1.C=CCc1ccccc1 |
| InChI | InChI=1S/C15H19F3N2.C9H10/c1-3-12(2)19-8-10-20(11-9-19)14-7-5-4-6-13(14)15(16,17)18;1-2-6-9-7-4-3-5-8-9/h4-7H,2-3,8-11H2,1H3;2-5,7-8H,1,6H2 |
| InChIKey | FOGRDQADMXZHEF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|