C18H21F3N2O — CID 143517588
(1R)-3-(4,6-dihydrofuro[3,4-c]pyrrol-5-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene (PubChem CID 143517588) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is (1R)-3-(4,6-dihydrofuro[3,4-c]pyrrol-5-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene.
| Compound Name | (1R)-3-(4,6-dihydrofuro[3,4-c]pyrrol-5-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 143517588 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (1R)-3-(4,6-dihydrofuro[3,4-c]pyrrol-5-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene |
| SMILES | Fc1ccc(F)c(F)c1.N[C@@H]1CCCC(N2Cc3cocc3C2)C1 |
| InChI | InChI=1S/C12H18N2O.C6H3F3/c13-11-2-1-3-12(4-11)14-5-9-7-15-8-10(9)6-14;7-4-1-2-5(8)6(9)3-4/h7-8,11-12H,1-6,13H2;1-3H/t11-,12?;/m1./s1 |
| InChIKey | VGAKPUPLPZFXJY-BAVFUAOSSA-N |
| XLogP | 3.97 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|