C17H21F3N4O — CID 143583699
(3S)-5-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)oxan-3-amine;1,2,4-trifluorobenzene (PubChem CID 143583699) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is (3S)-5-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)oxan-3-amine;1,2,4-trifluorobenzene.
| Compound Name | (3S)-5-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)oxan-3-amine;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 143583699 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3S)-5-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)oxan-3-amine;1,2,4-trifluorobenzene |
| SMILES | Fc1ccc(F)c(F)c1.N[C@@H]1COCC(N2CCc3cn[nH]c3C2)C1 |
| InChI | InChI=1S/C11H18N4O.C6H3F3/c12-9-3-10(7-16-6-9)15-2-1-8-4-13-14-11(8)5-15;7-4-1-2-5(8)6(9)3-4/h4,9-10H,1-3,5-7,12H2,(H,13,14);1-3H/t9-,10?;/m0./s1 |
| InChIKey | PVFGFKSVHPVGPA-KKFCBZOWSA-N |
| XLogP | 1.99 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|