C21H24F3N5 — CID 143674559
3-(11-methyl-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene (PubChem CID 143674559) has the molecular formula C21H24F3N5 and a molecular weight of 403.45 g/mol. Its IUPAC name is 3-(11-methyl-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene.
| Compound Name | 3-(11-methyl-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 143674559 |
| Molecular Formula | C21H24F3N5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-(11-methyl-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)cyclohexan-1-amine;1,2,4-trifluorobenzene |
| SMILES | Cc1cc2ncc3c(n2n1)CN(C1CCCC(N)C1)C3.Fc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H21N5.C6H3F3/c1-10-5-15-17-7-11-8-19(9-14(11)20(15)18-10)13-4-2-3-12(16)6-13;7-4-1-2-5(8)6(9)3-4/h5,7,12-13H,2-4,6,8-9,16H2,1H3;1-3H |
| InChIKey | MCRMJOXXJXECKQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|