C21H20N2O3 — CID 143517968
(5Z)-1-(3,5-dimethylphenyl)-6-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4-dione (PubChem CID 143517968) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (5Z)-1-(3,5-dimethylphenyl)-6-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4-dione.
| Compound Name | (5Z)-1-(3,5-dimethylphenyl)-6-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 143517968 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (5Z)-1-(3,5-dimethylphenyl)-6-hydroxy-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)NC(=O)/C(=C\C=C\c3ccccc3)C2O)c1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-11-15(2)13-17(12-14)23-20(25)18(19(24)22-21(23)26)10-6-9-16-7-4-3-5-8-16/h3-13,20,25H,1-2H3,(H,22,24,26)/b9-6+,18-10+ |
| InChIKey | NMKIQAZBDLABEC-XICJKMHVSA-N |
| XLogP | 3.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|