C21H18N2O3 — CID 741459
5-cinnamylidene-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 741459) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-cinnamylidene-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-cinnamylidene-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 741459 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5-cinnamylidene-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(C)cc(N2C(=O)NC(=O)C(=CC=Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C21H18N2O3/c1-14-11-15(2)13-17(12-14)23-20(25)18(19(24)22-21(23)26)10-6-9-16-7-4-3-5-8-16/h3-13H,1-2H3,(H,22,24,26) |
| InChIKey | PUSHQZYSDYSDSI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|