C23H22F3N3O2 — CID 143520405
4-[1-pyridin-3-yl-2-[2-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]ethyl]morpholine (PubChem CID 143520405) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 4-[1-pyridin-3-yl-2-[2-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]ethyl]morpholine.
| Compound Name | 4-[1-pyridin-3-yl-2-[2-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]ethyl]morpholine |
|---|---|
| PubChem CID | 143520405 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[1-pyridin-3-yl-2-[2-[3-(trifluoromethoxy)phenyl]-3-pyridinyl]ethyl]morpholine |
| SMILES | FC(F)(F)Oc1cccc(-c2ncccc2CC(c2cccnc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H22F3N3O2/c24-23(25,26)31-20-7-1-4-17(14-20)22-18(5-3-9-28-22)15-21(19-6-2-8-27-16-19)29-10-12-30-13-11-29/h1-9,14,16,21H,10-13,15H2 |
| InChIKey | DHPDHKUSRCEGSJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |