C11H21N3O — CID 143520858
1-[[4-[(Z)-1,3-diaminoprop-1-enyl]cyclohex-3-en-1-yl]amino]ethanol (PubChem CID 143520858) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-[[4-[(Z)-1,3-diaminoprop-1-enyl]cyclohex-3-en-1-yl]amino]ethanol.
| Compound Name | 1-[[4-[(Z)-1,3-diaminoprop-1-enyl]cyclohex-3-en-1-yl]amino]ethanol |
|---|---|
| PubChem CID | 143520858 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-[[4-[(Z)-1,3-diaminoprop-1-enyl]cyclohex-3-en-1-yl]amino]ethanol |
| SMILES | CC(O)NC1CC=C(/C(N)=C/CN)CC1 |
| InChI | InChI=1S/C11H21N3O/c1-8(15)14-10-4-2-9(3-5-10)11(13)6-7-12/h2,6,8,10,14-15H,3-5,7,12-13H2,1H3/b11-6- |
| InChIKey | JEUATQBUZBXGJM-WDZFZDKYSA-N |
| XLogP | 0.19 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|