C31H43N7O2 — CID 143520981
acetylene;[4-[4-[[4-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-pyrrolidin-2-ylmethanone;N-methylacetamide (PubChem CID 143520981) has the molecular formula C31H43N7O2 and a molecular weight of 545.73 g/mol. Its IUPAC name is acetylene;[4-[4-[[4-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-pyrrolidin-2-ylmethanone;N-methylacetamide.
| Compound Name | acetylene;[4-[4-[[4-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-pyrrolidin-2-ylmethanone;N-methylacetamide |
|---|---|
| PubChem CID | 143520981 |
| Molecular Formula | C31H43N7O2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | acetylene;[4-[4-[[4-[(2E,4Z)-hepta-2,4-dien-3-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]-pyrrolidin-2-ylmethanone;N-methylacetamide |
| SMILES | C#C.C/C=C(\C=C/CC)c1ccnc(Nc2ccc(N3CCN(C(=O)C4CCCN4)CC3)cc2)n1.CNC(C)=O |
| InChI | InChI=1S/C26H34N6O.C3H7NO.C2H2/c1-3-5-7-20(4-2)23-13-15-28-26(30-23)29-21-9-11-22(12-10-21)31-16-18-32(19-17-31)25(33)24-8-6-14-27-24;1-3(5)4-2;1-2/h4-5,7,9-13,15,24,27H,3,6,8,14,16-19H2,1-2H3,(H,28,29,30);1-2H3,(H,4,5);1-2H/b7-5-,20-4+;; |
| InChIKey | BUZRDDBRRBVVPN-FDXKLASFSA-N |
| XLogP | 3.99 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|