C35H36Cl2N4S — CID 143521149
N-[2-[4-[4-(2,4-dichlorophenyl)-2-[[4-(4-pentylphenyl)phenyl]methyl]imidazol-1-yl]anilino]ethyl]thiohydroxylamine (PubChem CID 143521149) has the molecular formula C35H36Cl2N4S and a molecular weight of 615.67 g/mol. Its IUPAC name is N-[2-[4-[4-(2,4-dichlorophenyl)-2-[[4-(4-pentylphenyl)phenyl]methyl]imidazol-1-yl]anilino]ethyl]thiohydroxylamine.
| Compound Name | N-[2-[4-[4-(2,4-dichlorophenyl)-2-[[4-(4-pentylphenyl)phenyl]methyl]imidazol-1-yl]anilino]ethyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143521149 |
| Molecular Formula | C35H36Cl2N4S |
| Molecular Weight | 615.67 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | N-[2-[4-[4-(2,4-dichlorophenyl)-2-[[4-(4-pentylphenyl)phenyl]methyl]imidazol-1-yl]anilino]ethyl]thiohydroxylamine |
| SMILES | CCCCCc1ccc(-c2ccc(Cc3nc(-c4ccc(Cl)cc4Cl)cn3-c3ccc(NCCNS)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H36Cl2N4S/c1-2-3-4-5-25-6-10-27(11-7-25)28-12-8-26(9-13-28)22-35-40-34(32-19-14-29(36)23-33(32)37)24-41(35)31-17-15-30(16-18-31)38-20-21-39-42/h6-19,23-24,38-39,42H,2-5,20-22H2,1H3 |
| InChIKey | CTJIAGYTWRSBQQ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.67 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|