C20H22N2O8 — CID 143521762
ethyl 3-(3,4-dihydroxyphenyl)-2-methyl-2-[[4-(nitrooxymethyl)benzoyl]amino]propanoate (PubChem CID 143521762) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydroxyphenyl)-2-methyl-2-[[4-(nitrooxymethyl)benzoyl]amino]propanoate.
| Compound Name | ethyl 3-(3,4-dihydroxyphenyl)-2-methyl-2-[[4-(nitrooxymethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 143521762 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 3-(3,4-dihydroxyphenyl)-2-methyl-2-[[4-(nitrooxymethyl)benzoyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(O)c(O)c1)NC(=O)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N2O8/c1-3-29-19(26)20(2,11-14-6-9-16(23)17(24)10-14)21-18(25)15-7-4-13(5-8-15)12-30-22(27)28/h4-10,23-24H,3,11-12H2,1-2H3,(H,21,25) |
| InChIKey | BMZCOPPHCIXDMF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|