C36H34N4O14 — CID 143521860
[4-[2-[[2-[3-(nitrooxymethyl)phenyl]acetyl]amino]propyl]-2-[2-[3-(nitrooxymethyl)phenyl]acetyl]oxyphenyl] 2-[3-(nitrooxymethyl)phenyl]acetate (PubChem CID 143521860) has the molecular formula C36H34N4O14 and a molecular weight of 746.68 g/mol. Its IUPAC name is [4-[2-[[2-[3-(nitrooxymethyl)phenyl]acetyl]amino]propyl]-2-[2-[3-(nitrooxymethyl)phenyl]acetyl]oxyphenyl] 2-[3-(nitrooxymethyl)phenyl]acetate.
| Compound Name | [4-[2-[[2-[3-(nitrooxymethyl)phenyl]acetyl]amino]propyl]-2-[2-[3-(nitrooxymethyl)phenyl]acetyl]oxyphenyl] 2-[3-(nitrooxymethyl)phenyl]acetate |
|---|---|
| PubChem CID | 143521860 |
| Molecular Formula | C36H34N4O14 |
| Molecular Weight | 746.68 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | [4-[2-[[2-[3-(nitrooxymethyl)phenyl]acetyl]amino]propyl]-2-[2-[3-(nitrooxymethyl)phenyl]acetyl]oxyphenyl] 2-[3-(nitrooxymethyl)phenyl]acetate |
| SMILES | CC(Cc1ccc(OC(=O)Cc2cccc(CO[N+](=O)[O-])c2)c(OC(=O)Cc2cccc(CO[N+](=O)[O-])c2)c1)NC(=O)Cc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H34N4O14/c1-24(37-34(41)18-25-5-2-8-29(14-25)21-50-38(44)45)13-28-11-12-32(53-35(42)19-26-6-3-9-30(15-26)22-51-39(46)47)33(17-28)54-36(43)20-27-7-4-10-31(16-27)23-52-40(48)49/h2-12,14-17,24H,13,18-23H2,1H3,(H,37,41) |
| InChIKey | BWGVQCHZHDTCNE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 238.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|