C30H44N4O3S — CID 143523442
(3Z,5Z)-18-cycloheptyl-N-dimethylsulfinamoyl-2,8-dimethyl-9-oxo-8,11-diazatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxamide;ethane (PubChem CID 143523442) has the molecular formula C30H44N4O3S and a molecular weight of 540.77 g/mol. Its IUPAC name is (3Z,5Z)-18-cycloheptyl-N-dimethylsulfinamoyl-2,8-dimethyl-9-oxo-8,11-diazatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxamide;ethane.
| Compound Name | (3Z,5Z)-18-cycloheptyl-N-dimethylsulfinamoyl-2,8-dimethyl-9-oxo-8,11-diazatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxamide;ethane |
|---|---|
| PubChem CID | 143523442 |
| Molecular Formula | C30H44N4O3S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (3Z,5Z)-18-cycloheptyl-N-dimethylsulfinamoyl-2,8-dimethyl-9-oxo-8,11-diazatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxamide;ethane |
| SMILES | CC.CC1/C=C\C=C/CN(C)C(=O)Cn2c1c(C1CCCCCC1)c1ccc(C(=O)NS(=O)N(C)C)cc12 |
| InChI | InChI=1S/C28H38N4O3S.C2H6/c1-20-12-8-7-11-17-31(4)25(33)19-32-24-18-22(28(34)29-36(35)30(2)3)15-16-23(24)26(27(20)32)21-13-9-5-6-10-14-21;1-2/h7-8,11-12,15-16,18,20-21H,5-6,9-10,13-14,17,19H2,1-4H3,(H,29,34);1-2H3/b11-7-,12-8-; |
| InChIKey | UKZJKBDTDNFFBK-AFGGWQTNSA-N |
| XLogP | 5.66 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |