About [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate
[N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate (PubChem CID 143524552) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate.
Molecular Properties
| Compound Name | [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate |
| PubChem CID | 143524552 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/C(C=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O2/c1-9(2)11(8-17)16-13(15)18-12(14)10-6-4-3-5-7-10/h3-9,11,14H,1-2H3,(H2,15,16)/b14-12+ |
| InChIKey | PICAGTIBQCNFMI-WYMLVPIESA-N |
| XLogP | 1.57 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate?
The IUPAC name of [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate (CID 143524552) is [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate.
What is the SMILES notation for [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate?
The canonical SMILES for [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate is [H]/N=C(/O/C(N)=N/C(C=O)C(C)C)c1ccccc1.
What is the InChIKey of [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate?
The InChIKey is PICAGTIBQCNFMI-WYMLVPIESA-N. The full InChI is InChI=1S/C13H17N3O2/c1-9(2)11(8-17)16-13(15)18-12(14)10-6-4-3-5-7-10/h3-9,11,14H,1-2H3,(H2,15,16)/b14-12+.
What are the key properties of [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate?
[N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate has a molecular weight of 247.30 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(3-methyl-1-oxobutan-2-yl)carbamimidoyl] benzenecarboximidate is sourced from PubChem (CID 143524552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).