C21H30O — CID 143528704
1-[1-[(2E,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-yl]oxypropyl]cyclohepta-1,3,5-triene (PubChem CID 143528704) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-[1-[(2E,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-yl]oxypropyl]cyclohepta-1,3,5-triene.
| Compound Name | 1-[1-[(2E,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-yl]oxypropyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143528704 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-[1-[(2E,4Z)-4-methyl-3-[(Z)-prop-1-enyl]hepta-2,4-dien-2-yl]oxypropyl]cyclohepta-1,3,5-triene |
| SMILES | C/C=C\C(\C(C)=C/CC)=C(\C)OC(CC)C1=CC=CC=CC1 |
| InChI | InChI=1S/C21H30O/c1-6-13-17(4)20(14-7-2)18(5)22-21(8-3)19-15-11-9-10-12-16-19/h7,9-15,21H,6,8,16H2,1-5H3/b14-7-,17-13-,20-18+ |
| InChIKey | UPQZOCCGDFFUSK-NKKUVBMWSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|