C10H15NO — CID 143530062
4-(ethenylamino)-2-methylcyclohepta-2,4-dien-1-ol (PubChem CID 143530062) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-(ethenylamino)-2-methylcyclohepta-2,4-dien-1-ol.
| Compound Name | 4-(ethenylamino)-2-methylcyclohepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 143530062 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-(ethenylamino)-2-methylcyclohepta-2,4-dien-1-ol |
| SMILES | C=CNC1=CCCC(O)C(C)=C1 |
| InChI | InChI=1S/C10H15NO/c1-3-11-9-5-4-6-10(12)8(2)7-9/h3,5,7,10-12H,1,4,6H2,2H3 |
| InChIKey | PWJQBZBPAKNIPM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |