C8H13NO — CID 143479730
[3-(methylamino)cyclohexa-1,3-dien-1-yl]methanol (PubChem CID 143479730) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is [3-(methylamino)cyclohexa-1,3-dien-1-yl]methanol.
| Compound Name | [3-(methylamino)cyclohexa-1,3-dien-1-yl]methanol |
|---|---|
| PubChem CID | 143479730 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | [3-(methylamino)cyclohexa-1,3-dien-1-yl]methanol |
| SMILES | CNC1=CCCC(CO)=C1 |
| InChI | InChI=1S/C8H13NO/c1-9-8-4-2-3-7(5-8)6-10/h4-5,9-10H,2-3,6H2,1H3 |
| InChIKey | OKWGRNVYNRMZGR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |