About 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol
4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol (PubChem CID 146478570) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol |
| PubChem CID | 146478570 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol |
| SMILES | C=C(C)CC1=CC(O)NC=C1 |
| InChI | InChI=1S/C9H13NO/c1-7(2)5-8-3-4-10-9(11)6-8/h3-4,6,9-11H,1,5H2,2H3 |
| InChIKey | WTKHULHIUOPFIJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol?
The IUPAC name of 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol (CID 146478570) is 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol?
The canonical SMILES for 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol is C=C(C)CC1=CC(O)NC=C1.
What is the InChIKey of 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol?
The InChIKey is WTKHULHIUOPFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7(2)5-8-3-4-10-9(11)6-8/h3-4,6,9-11H,1,5H2,2H3.
What are the key properties of 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol?
4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol has a molecular weight of 151.21 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 146478570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).