C9H13NO — CID 146478570
4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol (PubChem CID 146478570) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol.
| Compound Name | 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 146478570 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(2-methylprop-2-enyl)-1,2-dihydropyridin-2-ol |
| SMILES | C=C(C)CC1=CC(O)NC=C1 |
| InChI | InChI=1S/C9H13NO/c1-7(2)5-8-3-4-10-9(11)6-8/h3-4,6,9-11H,1,5H2,2H3 |
| InChIKey | WTKHULHIUOPFIJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|