C17H20N4O — CID 143530163
2-amino-9-cyclopentyl-1,2-dihydropyrido[2,3-b]indole-3-carboxamide (PubChem CID 143530163) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-amino-9-cyclopentyl-1,2-dihydropyrido[2,3-b]indole-3-carboxamide.
| Compound Name | 2-amino-9-cyclopentyl-1,2-dihydropyrido[2,3-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 143530163 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-amino-9-cyclopentyl-1,2-dihydropyrido[2,3-b]indole-3-carboxamide |
| SMILES | NC(=O)C1=Cc2c(n(C3CCCC3)c3ccccc23)NC1N |
| InChI | InChI=1S/C17H20N4O/c18-15-13(16(19)22)9-12-11-7-3-4-8-14(11)21(17(12)20-15)10-5-1-2-6-10/h3-4,7-10,15,20H,1-2,5-6,18H2,(H2,19,22) |
| InChIKey | MVEOFWBEVNMYAS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |