C31H27ClO6 — CID 143530748
6-chloro-7-hydroxyspiro[2,20-dioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,15,21-octaene-13,3'-2-benzofuran]-1',19-dione;ethane (PubChem CID 143530748) has the molecular formula C31H27ClO6 and a molecular weight of 531.00 g/mol. Its IUPAC name is 6-chloro-7-hydroxyspiro[2,20-dioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,15,21-octaene-13,3'-2-benzofuran]-1',19-dione;ethane.
| Compound Name | 6-chloro-7-hydroxyspiro[2,20-dioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,15,21-octaene-13,3'-2-benzofuran]-1',19-dione;ethane |
|---|---|
| PubChem CID | 143530748 |
| Molecular Formula | C31H27ClO6 |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 6-chloro-7-hydroxyspiro[2,20-dioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,10,15,21-octaene-13,3'-2-benzofuran]-1',19-dione;ethane |
| SMILES | CC.CC.O=C1CCc2cc3c(cc2O1)Oc1c(ccc2cc(O)c(Cl)cc12)C31OC(=O)c2ccccc21 |
| InChI | InChI=1S/C27H15ClO6.2C2H6/c28-20-11-16-13(10-21(20)29)5-7-18-25(16)33-23-12-22-14(6-8-24(30)32-22)9-19(23)27(18)17-4-2-1-3-15(17)26(31)34-27;2*1-2/h1-5,7,9-12,29H,6,8H2;2*1-2H3 |
| InChIKey | AIDDYRACFZHUML-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|