C24H31FN4O2 — CID 143531645
N-[3-[3-fluoro-4-(4-piperidin-1-ylbutylcarbamoylamino)phenyl]phenyl]acetamide (PubChem CID 143531645) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[3-[3-fluoro-4-(4-piperidin-1-ylbutylcarbamoylamino)phenyl]phenyl]acetamide.
| Compound Name | N-[3-[3-fluoro-4-(4-piperidin-1-ylbutylcarbamoylamino)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 143531645 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[3-[3-fluoro-4-(4-piperidin-1-ylbutylcarbamoylamino)phenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2ccc(NC(=O)NCCCCN3CCCCC3)c(F)c2)c1 |
| InChI | InChI=1S/C24H31FN4O2/c1-18(30)27-21-9-7-8-19(16-21)20-10-11-23(22(25)17-20)28-24(31)26-12-3-6-15-29-13-4-2-5-14-29/h7-11,16-17H,2-6,12-15H2,1H3,(H,27,30)(H2,26,28,31) |
| InChIKey | IAMSLNCUPVLBPP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|