C14H17BrN2O5 — CID 143535210
ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate (PubChem CID 143535210) has the molecular formula C14H17BrN2O5 and a molecular weight of 373.20 g/mol. Its IUPAC name is ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate.
| Compound Name | ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate |
|---|---|
| PubChem CID | 143535210 |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate |
| SMILES | CCOC(=O)/C(=N\NC)C(=O)c1cc(Br)c(OC)cc1OC |
| InChI | InChI=1S/C14H17BrN2O5/c1-5-22-14(19)12(17-16-2)13(18)8-6-9(15)11(21-4)7-10(8)20-3/h6-7,16H,5H2,1-4H3/b17-12- |
| InChIKey | HKVCZLWWHBUVFU-ATVHPVEESA-N |
| XLogP | 1.79 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|