About ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate
ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate (PubChem CID 143535210) has the molecular formula C14H17BrN2O5
and a molecular weight of 373.20 g/mol. Its IUPAC name is ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate |
| PubChem CID | 143535210 |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate |
| SMILES | CCOC(=O)/C(=N\NC)C(=O)c1cc(Br)c(OC)cc1OC |
| InChI | InChI=1S/C14H17BrN2O5/c1-5-22-14(19)12(17-16-2)13(18)8-6-9(15)11(21-4)7-10(8)20-3/h6-7,16H,5H2,1-4H3/b17-12- |
| InChIKey | HKVCZLWWHBUVFU-ATVHPVEESA-N |
| XLogP | 1.79 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate?
The IUPAC name of ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate (CID 143535210) is ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate.
What is the SMILES notation for ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate?
The canonical SMILES for ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate is CCOC(=O)/C(=N\NC)C(=O)c1cc(Br)c(OC)cc1OC.
What is the InChIKey of ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate?
The InChIKey is HKVCZLWWHBUVFU-ATVHPVEESA-N. The full InChI is InChI=1S/C14H17BrN2O5/c1-5-22-14(19)12(17-16-2)13(18)8-6-9(15)11(21-4)7-10(8)20-3/h6-7,16H,5H2,1-4H3/b17-12-.
What are the key properties of ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate?
ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate has a molecular weight of 373.20 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(methylhydrazinylidene)-3-oxopropanoate is sourced from PubChem (CID 143535210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).