C14H16N4OS2 — CID 143535514
2-[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]-1,1-dimethylhydrazine (PubChem CID 143535514) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]-1,1-dimethylhydrazine.
| Compound Name | 2-[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 143535514 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[5-(methoxymethyl)-2-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]-1,1-dimethylhydrazine |
| SMILES | COCc1csc2nc(-c3cccs3)nc(NN(C)C)c12 |
| InChI | InChI=1S/C14H16N4OS2/c1-18(2)17-13-11-9(7-19-3)8-21-14(11)16-12(15-13)10-5-4-6-20-10/h4-6,8H,7H2,1-3H3,(H,15,16,17) |
| InChIKey | LJWNXZFBURQJJL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|