C31H39ClN5O4+ — CID 143535856
[1-[4-[4-(3-imidazol-1-ylpropylamino)butoxy]phenyl]-2-(2-methoxyethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl]chloranium (PubChem CID 143535856) has the molecular formula C31H39ClN5O4+ and a molecular weight of 581.14 g/mol. Its IUPAC name is [1-[4-[4-(3-imidazol-1-ylpropylamino)butoxy]phenyl]-2-(2-methoxyethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl]chloranium.
| Compound Name | [1-[4-[4-(3-imidazol-1-ylpropylamino)butoxy]phenyl]-2-(2-methoxyethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl]chloranium |
|---|---|
| PubChem CID | 143535856 |
| Molecular Formula | C31H39ClN5O4+ |
| Molecular Weight | 581.14 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | [1-[4-[4-(3-imidazol-1-ylpropylamino)butoxy]phenyl]-2-(2-methoxyethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl]chloranium |
| SMILES | COCCOC(=O)N1CCc2c([nH]c3ccc([ClH+])cc23)C1c1ccc(OCCCCNCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C31H39ClN5O4/c1-39-19-20-41-31(38)37-16-11-26-27-21-24(32)7-10-28(27)35-29(26)30(37)23-5-8-25(9-6-23)40-18-3-2-12-33-13-4-15-36-17-14-34-22-36/h5-10,14,17,21-22,30,32-33,35H,2-4,11-13,15-16,18-20H2,1H3/q+1 |
| InChIKey | JKVUUEWEUXVOMT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 93.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|