C22H32BNS — CID 143536789
ethane;methylidene-(5-methylthiophen-2-yl)borane;3-methyl-1-(1-phenylethenyl)piperidine (PubChem CID 143536789) has the molecular formula C22H32BNS and a molecular weight of 353.38 g/mol. Its IUPAC name is ethane;methylidene-(5-methylthiophen-2-yl)borane;3-methyl-1-(1-phenylethenyl)piperidine.
| Compound Name | ethane;methylidene-(5-methylthiophen-2-yl)borane;3-methyl-1-(1-phenylethenyl)piperidine |
|---|---|
| PubChem CID | 143536789 |
| Molecular Formula | C22H32BNS |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | ethane;methylidene-(5-methylthiophen-2-yl)borane;3-methyl-1-(1-phenylethenyl)piperidine |
| SMILES | C=Bc1ccc(C)s1.C=C(c1ccccc1)N1CCCC(C)C1.CC |
| InChI | InChI=1S/C14H19N.C6H7BS.C2H6/c1-12-7-6-10-15(11-12)13(2)14-8-4-3-5-9-14;1-5-3-4-6(7-2)8-5;1-2/h3-5,8-9,12H,2,6-7,10-11H2,1H3;3-4H,2H2,1H3;1-2H3 |
| InChIKey | MRAKXXVRANCVII-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|