C26H35N5O2 — CID 143540793
2-[[2-[(3S)-3-methyl-4-(oxan-4-yl)piperazin-1-yl]oxiran-2-yl]methyl]-6-pyrimidin-5-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 143540793) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-[[2-[(3S)-3-methyl-4-(oxan-4-yl)piperazin-1-yl]oxiran-2-yl]methyl]-6-pyrimidin-5-yl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[[2-[(3S)-3-methyl-4-(oxan-4-yl)piperazin-1-yl]oxiran-2-yl]methyl]-6-pyrimidin-5-yl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143540793 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 2-[[2-[(3S)-3-methyl-4-(oxan-4-yl)piperazin-1-yl]oxiran-2-yl]methyl]-6-pyrimidin-5-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | C[C@H]1CN(C2(CN3CCc4cc(-c5cncnc5)ccc4C3)CO2)CCN1C1CCOCC1 |
| InChI | InChI=1S/C26H35N5O2/c1-20-15-30(8-9-31(20)25-5-10-32-11-6-25)26(18-33-26)17-29-7-4-22-12-21(2-3-23(22)16-29)24-13-27-19-28-14-24/h2-3,12-14,19-20,25H,4-11,15-18H2,1H3/t20-,26?/m0/s1 |
| InChIKey | FAPOMKOOWPXQPF-DQUNLGLBSA-N |
| XLogP | 2.41 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|