C29H43N3O2 — CID 143543925
[4-[(1-ethyl-9-methyl-1,3-diazonin-2-yl)methyl]phenyl]-(3-methylpyrrolidin-1-yl)methanone;1-methoxypentane (PubChem CID 143543925) has the molecular formula C29H43N3O2 and a molecular weight of 465.68 g/mol. Its IUPAC name is [4-[(1-ethyl-9-methyl-1,3-diazonin-2-yl)methyl]phenyl]-(3-methylpyrrolidin-1-yl)methanone;1-methoxypentane.
| Compound Name | [4-[(1-ethyl-9-methyl-1,3-diazonin-2-yl)methyl]phenyl]-(3-methylpyrrolidin-1-yl)methanone;1-methoxypentane |
|---|---|
| PubChem CID | 143543925 |
| Molecular Formula | C29H43N3O2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | [4-[(1-ethyl-9-methyl-1,3-diazonin-2-yl)methyl]phenyl]-(3-methylpyrrolidin-1-yl)methanone;1-methoxypentane |
| SMILES | CCCCCOC.CCn1c(C)cccccnc1Cc1ccc(C(=O)N2CCC(C)C2)cc1 |
| InChI | InChI=1S/C23H29N3O.C6H14O/c1-4-26-19(3)8-6-5-7-14-24-22(26)16-20-9-11-21(12-10-20)23(27)25-15-13-18(2)17-25;1-3-4-5-6-7-2/h5-12,14,18H,4,13,15-17H2,1-3H3;3-6H2,1-2H3/b6-5-,14-7-,19-8-,24-22-; |
| InChIKey | QEHZHZDTUANTIU-KWZDDCNSSA-N |
| XLogP | 6.23 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|