C23H14F5N3 — CID 143549903
(Z)-2-(2,3-difluorophenyl)-3-[4-[2-(trifluoromethyl)-3a,4-dihydrobenzimidazol-1-yl]phenyl]prop-2-enenitrile (PubChem CID 143549903) has the molecular formula C23H14F5N3 and a molecular weight of 427.38 g/mol. Its IUPAC name is (Z)-2-(2,3-difluorophenyl)-3-[4-[2-(trifluoromethyl)-3a,4-dihydrobenzimidazol-1-yl]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(2,3-difluorophenyl)-3-[4-[2-(trifluoromethyl)-3a,4-dihydrobenzimidazol-1-yl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 143549903 |
| Molecular Formula | C23H14F5N3 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (Z)-2-(2,3-difluorophenyl)-3-[4-[2-(trifluoromethyl)-3a,4-dihydrobenzimidazol-1-yl]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(N2C3=CC=CCC3N=C2C(F)(F)F)cc1)c1cccc(F)c1F |
| InChI | InChI=1S/C23H14F5N3/c24-18-5-3-4-17(21(18)25)15(13-29)12-14-8-10-16(11-9-14)31-20-7-2-1-6-19(20)30-22(31)23(26,27)28/h1-5,7-12,19H,6H2/b15-12+ |
| InChIKey | OJNCVZHDCJEGQE-NTCAYCPXSA-N |
| XLogP | 6.02 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|