C13H21NO — CID 143551128
(3E)-3-ethenyl-1-piperidin-1-ylhexa-3,5-dien-2-ol (PubChem CID 143551128) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (3E)-3-ethenyl-1-piperidin-1-ylhexa-3,5-dien-2-ol.
| Compound Name | (3E)-3-ethenyl-1-piperidin-1-ylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 143551128 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (3E)-3-ethenyl-1-piperidin-1-ylhexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)C(O)CN1CCCCC1 |
| InChI | InChI=1S/C13H21NO/c1-3-8-12(4-2)13(15)11-14-9-6-5-7-10-14/h3-4,8,13,15H,1-2,5-7,9-11H2/b12-8+ |
| InChIKey | WYDLJCIJVGYVJY-XYOKQWHBSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|