C20H34O2 — CID 143551639
4-[(2E)-cyclodec-2-en-1-yl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol (PubChem CID 143551639) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-[(2E)-cyclodec-2-en-1-yl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol.
| Compound Name | 4-[(2E)-cyclodec-2-en-1-yl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 143551639 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 4-[(2E)-cyclodec-2-en-1-yl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| SMILES | OC1CCC(OC2/C=C/CCCCCCC2)C2CCCCC12 |
| InChI | InChI=1S/C20H34O2/c21-19-14-15-20(18-13-9-8-12-17(18)19)22-16-10-6-4-2-1-3-5-7-11-16/h6,10,16-21H,1-5,7-9,11-15H2/b10-6+ |
| InChIKey | QEHKCFOGQGHTNV-UXBLZVDNSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|