C15H21F3N4O4 — CID 143551992
2,2-difluoro-N-[(2S)-3-[3-fluoro-N-hydroxy-4-(1,2,5-oxadiazepan-5-yl)anilino]-2-hydroxypropyl]acetamide (PubChem CID 143551992) has the molecular formula C15H21F3N4O4 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2S)-3-[3-fluoro-N-hydroxy-4-(1,2,5-oxadiazepan-5-yl)anilino]-2-hydroxypropyl]acetamide.
| Compound Name | 2,2-difluoro-N-[(2S)-3-[3-fluoro-N-hydroxy-4-(1,2,5-oxadiazepan-5-yl)anilino]-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 143551992 |
| Molecular Formula | C15H21F3N4O4 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2,2-difluoro-N-[(2S)-3-[3-fluoro-N-hydroxy-4-(1,2,5-oxadiazepan-5-yl)anilino]-2-hydroxypropyl]acetamide |
| SMILES | O=C(NC[C@H](O)CN(O)c1ccc(N2CCNOCC2)c(F)c1)C(F)F |
| InChI | InChI=1S/C15H21F3N4O4/c16-12-7-10(1-2-13(12)21-4-3-20-26-6-5-21)22(25)9-11(23)8-19-15(24)14(17)18/h1-2,7,11,14,20,23,25H,3-6,8-9H2,(H,19,24)/t11-/m0/s1 |
| InChIKey | JGBMPGJUEOONHJ-NSHDSACASA-N |
| XLogP | 0.10 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|