C10H18N4 — CID 143552121
4-N,4-N-bis(2-aminoethyl)benzene-1,4-diamine (PubChem CID 143552121) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N,4-N-bis(2-aminoethyl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-bis(2-aminoethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 143552121 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-N,4-N-bis(2-aminoethyl)benzene-1,4-diamine |
| SMILES | NCCN(CCN)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H18N4/c11-5-7-14(8-6-12)10-3-1-9(13)2-4-10/h1-4H,5-8,11-13H2 |
| InChIKey | NTASVJHVFNEURS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|