C11H13NO2S — CID 143554738
5,7,8-trimethyl-7-sulfanyl-3H-cyclohepta[d][1,3]oxazol-2-one (PubChem CID 143554738) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 5,7,8-trimethyl-7-sulfanyl-3H-cyclohepta[d][1,3]oxazol-2-one.
| Compound Name | 5,7,8-trimethyl-7-sulfanyl-3H-cyclohepta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 143554738 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 5,7,8-trimethyl-7-sulfanyl-3H-cyclohepta[d][1,3]oxazol-2-one |
| SMILES | CC1=CC(C)(S)C(C)=c2oc(=O)[nH]c2=C1 |
| InChI | InChI=1S/C11H13NO2S/c1-6-4-8-9(14-10(13)12-8)7(2)11(3,15)5-6/h4-5,15H,1-3H3,(H,12,13) |
| InChIKey | SBBQZLHCGMVSRW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|