C21H22F4N4O3S — CID 143555253
N-[[(5S)-3-[4-[[4-(dimethylamino)-7-hydroxycyclohepta-1,3,5-trien-1-yl]amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide (PubChem CID 143555253) has the molecular formula C21H22F4N4O3S and a molecular weight of 486.49 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[[4-(dimethylamino)-7-hydroxycyclohepta-1,3,5-trien-1-yl]amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide.
| Compound Name | N-[[(5S)-3-[4-[[4-(dimethylamino)-7-hydroxycyclohepta-1,3,5-trien-1-yl]amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
|---|---|
| PubChem CID | 143555253 |
| Molecular Formula | C21H22F4N4O3S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-[[(5S)-3-[4-[[4-(dimethylamino)-7-hydroxycyclohepta-1,3,5-trien-1-yl]amino]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
| SMILES | CN(C)C1=CC=C(Nc2c(F)cc(N3C[C@H](CNC(=S)C(F)F)OC3=O)cc2F)C(O)C=C1 |
| InChI | InChI=1S/C21H22F4N4O3S/c1-28(2)11-3-5-16(17(30)6-4-11)27-18-14(22)7-12(8-15(18)23)29-10-13(32-21(29)31)9-26-20(33)19(24)25/h3-8,13,17,19,27,30H,9-10H2,1-2H3,(H,26,33)/t13-,17?/m0/s1 |
| InChIKey | JWOGKNGFVIGBMK-CWQZNGJJSA-N |
| XLogP | 3.14 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|