C18H18N2O3 — CID 143556678
2,3-dihydro-1-benzofuran-6-amine;3-(3-iminoprop-1-en-2-yl)benzoic acid (PubChem CID 143556678) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-6-amine;3-(3-iminoprop-1-en-2-yl)benzoic acid.
| Compound Name | 2,3-dihydro-1-benzofuran-6-amine;3-(3-iminoprop-1-en-2-yl)benzoic acid |
|---|---|
| PubChem CID | 143556678 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-6-amine;3-(3-iminoprop-1-en-2-yl)benzoic acid |
| SMILES | Nc1ccc2c(c1)OCC2.[H]/N=C/C(=C)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C10H9NO2.C8H9NO/c1-7(6-11)8-3-2-4-9(5-8)10(12)13;9-7-2-1-6-3-4-10-8(6)5-7/h2-6,11H,1H2,(H,12,13);1-2,5H,3-4,9H2/b11-6+; |
| InChIKey | GJVUXRYXFIHTAN-ICSBZGNSSA-N |
| XLogP | 3.25 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|