C17H15NO3 — CID 22302430
[2-(2,3-dihydro-1-benzofuran-5-yl)-2-iminoethyl] benzoate (PubChem CID 22302430) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is [2-(2,3-dihydro-1-benzofuran-5-yl)-2-iminoethyl] benzoate.
| Compound Name | [2-(2,3-dihydro-1-benzofuran-5-yl)-2-iminoethyl] benzoate |
|---|---|
| PubChem CID | 22302430 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [2-(2,3-dihydro-1-benzofuran-5-yl)-2-iminoethyl] benzoate |
| SMILES | [H]/N=C(\COC(=O)c1ccccc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H15NO3/c18-15(11-21-17(19)12-4-2-1-3-5-12)13-6-7-16-14(10-13)8-9-20-16/h1-7,10,18H,8-9,11H2/b18-15+ |
| InChIKey | XBPFSAYHIKZRDG-OBGWFSINSA-N |
| XLogP | 2.85 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|