C22H26ClN3O — CID 143560650
N'-(chloromethyl)-N-[4-(2-cyanophenyl)phenyl]-N-(1-hydroxypropan-2-yl)pentanimidamide (PubChem CID 143560650) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is N'-(chloromethyl)-N-[4-(2-cyanophenyl)phenyl]-N-(1-hydroxypropan-2-yl)pentanimidamide.
| Compound Name | N'-(chloromethyl)-N-[4-(2-cyanophenyl)phenyl]-N-(1-hydroxypropan-2-yl)pentanimidamide |
|---|---|
| PubChem CID | 143560650 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N'-(chloromethyl)-N-[4-(2-cyanophenyl)phenyl]-N-(1-hydroxypropan-2-yl)pentanimidamide |
| SMILES | CCCC/C(=N/CCl)N(c1ccc(-c2ccccc2C#N)cc1)C(C)CO |
| InChI | InChI=1S/C22H26ClN3O/c1-3-4-9-22(25-16-23)26(17(2)15-27)20-12-10-18(11-13-20)21-8-6-5-7-19(21)14-24/h5-8,10-13,17,27H,3-4,9,15-16H2,1-2H3/b25-22- |
| InChIKey | JRIMMASHWUSCGO-LVWGJNHUSA-N |
| XLogP | 5.20 |
| TPSA | 59.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|