About propane;4-prop-1-en-2-yl-1H-indole-3-thiol
propane;4-prop-1-en-2-yl-1H-indole-3-thiol (PubChem CID 143564482) has the molecular formula C14H19NS
and a molecular weight of 233.38 g/mol. Its IUPAC name is propane;4-prop-1-en-2-yl-1H-indole-3-thiol.
Molecular Properties
| Compound Name | propane;4-prop-1-en-2-yl-1H-indole-3-thiol |
| PubChem CID | 143564482 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | propane;4-prop-1-en-2-yl-1H-indole-3-thiol |
| SMILES | C=C(C)c1cccc2[nH]cc(S)c12.CCC |
| InChI | InChI=1S/C11H11NS.C3H8/c1-7(2)8-4-3-5-9-11(8)10(13)6-12-9;1-3-2/h3-6,12-13H,1H2,2H3;3H2,1-2H3 |
| InChIKey | IFKZAOQILHHBRN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propane;4-prop-1-en-2-yl-1H-indole-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;4-prop-1-en-2-yl-1H-indole-3-thiol?
The IUPAC name of propane;4-prop-1-en-2-yl-1H-indole-3-thiol (CID 143564482) is propane;4-prop-1-en-2-yl-1H-indole-3-thiol.
What is the SMILES notation for propane;4-prop-1-en-2-yl-1H-indole-3-thiol?
The canonical SMILES for propane;4-prop-1-en-2-yl-1H-indole-3-thiol is C=C(C)c1cccc2[nH]cc(S)c12.CCC.
What is the InChIKey of propane;4-prop-1-en-2-yl-1H-indole-3-thiol?
The InChIKey is IFKZAOQILHHBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS.C3H8/c1-7(2)8-4-3-5-9-11(8)10(13)6-12-9;1-3-2/h3-6,12-13H,1H2,2H3;3H2,1-2H3.
What are the key properties of propane;4-prop-1-en-2-yl-1H-indole-3-thiol?
propane;4-prop-1-en-2-yl-1H-indole-3-thiol has a molecular weight of 233.38 g/mol, XLogP of 4.91, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;4-prop-1-en-2-yl-1H-indole-3-thiol is sourced from PubChem (CID 143564482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).