C30H36N4O2 — CID 143569348
acetylene;2-[4-(2-aminobutylamino)quinazolin-2-yl]-4-prop-1-en-2-ylphenol;(2E)-2-propylidene-3H-furan (PubChem CID 143569348) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is acetylene;2-[4-(2-aminobutylamino)quinazolin-2-yl]-4-prop-1-en-2-ylphenol;(2E)-2-propylidene-3H-furan.
| Compound Name | acetylene;2-[4-(2-aminobutylamino)quinazolin-2-yl]-4-prop-1-en-2-ylphenol;(2E)-2-propylidene-3H-furan |
|---|---|
| PubChem CID | 143569348 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | acetylene;2-[4-(2-aminobutylamino)quinazolin-2-yl]-4-prop-1-en-2-ylphenol;(2E)-2-propylidene-3H-furan |
| SMILES | C#C.C=C(C)c1ccc(O)c(-c2nc(NCC(N)CC)c3ccccc3n2)c1.CC/C=C1\CC=CO1 |
| InChI | InChI=1S/C21H24N4O.C7H10O.C2H2/c1-4-15(22)12-23-20-16-7-5-6-8-18(16)24-21(25-20)17-11-14(13(2)3)9-10-19(17)26;1-2-4-7-5-3-6-8-7;1-2/h5-11,15,26H,2,4,12,22H2,1,3H3,(H,23,24,25);3-4,6H,2,5H2,1H3;1-2H/b;7-4+; |
| InChIKey | DHOVQKIWDXSFFD-FHVKFMIDSA-N |
| XLogP | 6.65 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|