C21H30N2O6S — CID 143570923
[4-[(Z,2E)-3-methyl-2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxyethylidene]pent-3-enyl]phenyl]urea (PubChem CID 143570923) has the molecular formula C21H30N2O6S and a molecular weight of 438.55 g/mol. Its IUPAC name is [4-[(Z,2E)-3-methyl-2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxyethylidene]pent-3-enyl]phenyl]urea.
| Compound Name | [4-[(Z,2E)-3-methyl-2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxyethylidene]pent-3-enyl]phenyl]urea |
|---|---|
| PubChem CID | 143570923 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [4-[(Z,2E)-3-methyl-2-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxyethylidene]pent-3-enyl]phenyl]urea |
| SMILES | C/C=C(C)\C(Cc1ccc(NC(N)=O)cc1)=C(/C)O[C@@H]1S[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H30N2O6S/c1-4-11(2)15(9-13-5-7-14(8-6-13)23-21(22)28)12(3)29-20-19(27)18(26)17(25)16(10-24)30-20/h4-8,16-20,24-27H,9-10H2,1-3H3,(H3,22,23,28)/b11-4-,15-12+/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | FINACQYGYQFWRJ-NWEJMBOBSA-N |
| XLogP | 1.49 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|