C23H36N4O6S — CID 143575326
[(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)thian-2-yl] (Z)-3-amino-2-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]phenyl]methyl]-4-methylpent-2-enimidate (PubChem CID 143575326) has the molecular formula C23H36N4O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is [(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)thian-2-yl] (Z)-3-amino-2-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]phenyl]methyl]-4-methylpent-2-enimidate.
| Compound Name | [(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)thian-2-yl] (Z)-3-amino-2-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]phenyl]methyl]-4-methylpent-2-enimidate |
|---|---|
| PubChem CID | 143575326 |
| Molecular Formula | C23H36N4O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [(2R,5S)-4,5-dihydroxy-6-(hydroxymethyl)thian-2-yl] (Z)-3-amino-2-[[4-[2-[(2-amino-2-oxoethyl)amino]ethoxy]phenyl]methyl]-4-methylpent-2-enimidate |
| SMILES | [H]/N=C(O[C@H]1CC(O)[C@H](O)C(CO)S1)\C(Cc1ccc(OCCNCC(N)=O)cc1)=C(/N)C(C)C |
| InChI | InChI=1S/C23H36N4O6S/c1-13(2)21(25)16(23(26)33-20-10-17(29)22(31)18(12-28)34-20)9-14-3-5-15(6-4-14)32-8-7-27-11-19(24)30/h3-6,13,17-18,20,22,26-29,31H,7-12,25H2,1-2H3,(H2,24,30)/b21-16-,26-23+/t17?,18?,20-,22+/m1/s1 |
| InChIKey | HFBURBFASRWESG-GSVFMNITSA-N |
| XLogP | 0.09 |
| TPSA | 184.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|