C22H32N4O7S — CID 23652165
2-[4-[[5-propan-2-yl-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenoxy]ethylurea (PubChem CID 23652165) has the molecular formula C22H32N4O7S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[4-[[5-propan-2-yl-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenoxy]ethylurea.
| Compound Name | 2-[4-[[5-propan-2-yl-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenoxy]ethylurea |
|---|---|
| PubChem CID | 23652165 |
| Molecular Formula | C22H32N4O7S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-[4-[[5-propan-2-yl-3-[(2R,3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]oxy-1H-pyrazol-4-yl]methyl]phenoxy]ethylurea |
| SMILES | CC(C)c1[nH]nc(O[C@@H]2S[C@H](CO)[C@@H](O)C(O)[C@H]2O)c1Cc1ccc(OCCNC(N)=O)cc1 |
| InChI | InChI=1S/C22H32N4O7S/c1-11(2)16-14(9-12-3-5-13(6-4-12)32-8-7-24-22(23)31)20(26-25-16)33-21-19(30)18(29)17(28)15(10-27)34-21/h3-6,11,15,17-19,21,27-30H,7-10H2,1-2H3,(H,25,26)(H3,23,24,31)/t15-,17-,18?,19-,21-/m1/s1 |
| InChIKey | YOBUOUPSCJNWES-UBRBNGLMSA-N |
| XLogP | 0.07 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|