C16H34OS — CID 143571588
2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid (PubChem CID 143571588) has the molecular formula C16H34OS and a molecular weight of 274.51 g/mol. Its IUPAC name is 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid.
| Compound Name | 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid |
|---|---|
| PubChem CID | 143571588 |
| Molecular Formula | C16H34OS |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid |
| SMILES | C=C(C)CCCC(C)C.CCC(C)(C)C.O=CS |
| InChI | InChI=1S/C9H18.C6H14.CH2OS/c1-8(2)6-5-7-9(3)4;1-5-6(2,3)4;2-1-3/h9H,1,5-7H2,2-4H3;5H2,1-4H3;1H,(H,2,3) |
| InChIKey | YELOMCYEQZBUBZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|