About 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid
2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid (PubChem CID 143571588) has the molecular formula C16H34OS
and a molecular weight of 274.51 g/mol. Its IUPAC name is 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid.
Molecular Properties
| Compound Name | 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid |
| PubChem CID | 143571588 |
| Molecular Formula | C16H34OS |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid |
| SMILES | C=C(C)CCCC(C)C.CCC(C)(C)C.O=CS |
| InChI | InChI=1S/C9H18.C6H14.CH2OS/c1-8(2)6-5-7-9(3)4;1-5-6(2,3)4;2-1-3/h9H,1,5-7H2,2-4H3;5H2,1-4H3;1H,(H,2,3) |
| InChIKey | YELOMCYEQZBUBZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid?
The IUPAC name of 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid (CID 143571588) is 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid.
What is the SMILES notation for 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid?
The canonical SMILES for 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid is C=C(C)CCCC(C)C.CCC(C)(C)C.O=CS.
What is the InChIKey of 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid?
The InChIKey is YELOMCYEQZBUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C6H14.CH2OS/c1-8(2)6-5-7-9(3)4;1-5-6(2,3)4;2-1-3/h9H,1,5-7H2,2-4H3;5H2,1-4H3;1H,(H,2,3).
What are the key properties of 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid?
2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid has a molecular weight of 274.51 g/mol, XLogP of 5.94, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutane;2,6-dimethylhept-1-ene;methanethioic S-acid is sourced from PubChem (CID 143571588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).