C29H36N6O2S — CID 143572410
acetylene;N-[(2E,5E)-5-[(E)-2-[2-[2-[(Z)-hydrazinylidenemethyl]phenyl]-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-4-yl]ethenyl]hepta-2,5-dien-3-yl]acetamide (PubChem CID 143572410) has the molecular formula C29H36N6O2S and a molecular weight of 532.71 g/mol. Its IUPAC name is acetylene;N-[(2E,5E)-5-[(E)-2-[2-[2-[(Z)-hydrazinylidenemethyl]phenyl]-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-4-yl]ethenyl]hepta-2,5-dien-3-yl]acetamide.
| Compound Name | acetylene;N-[(2E,5E)-5-[(E)-2-[2-[2-[(Z)-hydrazinylidenemethyl]phenyl]-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-4-yl]ethenyl]hepta-2,5-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 143572410 |
| Molecular Formula | C29H36N6O2S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | acetylene;N-[(2E,5E)-5-[(E)-2-[2-[2-[(Z)-hydrazinylidenemethyl]phenyl]-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-4-yl]ethenyl]hepta-2,5-dien-3-yl]acetamide |
| SMILES | C#C.C/C=C(/C=C/c1nc(-c2ccccc2/C=N\N)nc(N2CCOCC2)c1SC)C/C(=C\C)NC(C)=O |
| InChI | InChI=1S/C27H34N6O2S.C2H2/c1-5-20(17-22(6-2)30-19(3)34)11-12-24-25(36-4)27(33-13-15-35-16-14-33)32-26(31-24)23-10-8-7-9-21(23)18-29-28;1-2/h5-12,18H,13-17,28H2,1-4H3,(H,30,34);1-2H/b12-11+,20-5-,22-6+,29-18-; |
| InChIKey | JKKDTFLRLNKZTP-ZFMJQFMXSA-N |
| XLogP | 4.63 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|