C17H26N2 — CID 143573141
(Z)-4-cyclohepta-1,3,5-trien-1-yl-N,N-dipropylbut-2-enimidamide (PubChem CID 143573141) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (Z)-4-cyclohepta-1,3,5-trien-1-yl-N,N-dipropylbut-2-enimidamide.
| Compound Name | (Z)-4-cyclohepta-1,3,5-trien-1-yl-N,N-dipropylbut-2-enimidamide |
|---|---|
| PubChem CID | 143573141 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (Z)-4-cyclohepta-1,3,5-trien-1-yl-N,N-dipropylbut-2-enimidamide |
| SMILES | [H]/N=C(/C=C\CC1=CC=CC=CC1)N(CCC)CCC |
| InChI | InChI=1S/C17H26N2/c1-3-14-19(15-4-2)17(18)13-9-12-16-10-7-5-6-8-11-16/h5-10,13,18H,3-4,11-12,14-15H2,1-2H3/b13-9-,18-17- |
| InChIKey | TWEDIRMSNOIGFU-LTVWWZOSSA-N |
| XLogP | 4.47 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|