C17H26N4O2 — CID 143573583
ethyl 2-[[(E)-3-amino-3-phenyl-2-piperazin-1-ylprop-1-enyl]amino]acetate (PubChem CID 143573583) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-amino-3-phenyl-2-piperazin-1-ylprop-1-enyl]amino]acetate.
| Compound Name | ethyl 2-[[(E)-3-amino-3-phenyl-2-piperazin-1-ylprop-1-enyl]amino]acetate |
|---|---|
| PubChem CID | 143573583 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | ethyl 2-[[(E)-3-amino-3-phenyl-2-piperazin-1-ylprop-1-enyl]amino]acetate |
| SMILES | CCOC(=O)CN/C=C(\C(N)c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C17H26N4O2/c1-2-23-16(22)13-20-12-15(21-10-8-19-9-11-21)17(18)14-6-4-3-5-7-14/h3-7,12,17,19-20H,2,8-11,13,18H2,1H3/b15-12+ |
| InChIKey | YQSZBEQOUJUHDB-NTCAYCPXSA-N |
| XLogP | 0.59 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |