C23H40N6 — CID 143574862
N-(1-cyclopropylpropan-2-yl)cyclohexanamine;N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide (PubChem CID 143574862) has the molecular formula C23H40N6 and a molecular weight of 400.62 g/mol. Its IUPAC name is N-(1-cyclopropylpropan-2-yl)cyclohexanamine;N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide.
| Compound Name | N-(1-cyclopropylpropan-2-yl)cyclohexanamine;N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 143574862 |
| Molecular Formula | C23H40N6 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | N-(1-cyclopropylpropan-2-yl)cyclohexanamine;N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C=C\N=C(/C)N)c1cnn(C)c1NC.CC(CC1CC1)NC1CCCCC1 |
| InChI | InChI=1S/C12H23N.C11H17N5/c1-10(9-11-7-8-11)13-12-5-3-2-4-6-12;1-8(5-6-14-9(2)12)10-7-15-16(4)11(10)13-3/h10-13H,2-9H2,1H3;5-7,13H,1H2,2-4H3,(H2,12,14)/b;6-5- |
| InChIKey | BUQIDVUGYWAUNS-JXGYXAOLSA-N |
| XLogP | 4.46 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|