C12H19N3 — CID 115921218
N-(1-cyclopropylpent-4-enyl)-2-methylpyrazol-3-amine (PubChem CID 115921218) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-(1-cyclopropylpent-4-enyl)-2-methylpyrazol-3-amine.
| Compound Name | N-(1-cyclopropylpent-4-enyl)-2-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 115921218 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-(1-cyclopropylpent-4-enyl)-2-methylpyrazol-3-amine |
| SMILES | C=CCCC(Nc1ccnn1C)C1CC1 |
| InChI | InChI=1S/C12H19N3/c1-3-4-5-11(10-6-7-10)14-12-8-9-13-15(12)2/h3,8-11,14H,1,4-7H2,2H3 |
| InChIKey | QWYNMQXQPJLTQP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|