C23H47N3 — CID 143843846
4-but-1-en-2-yl-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylpyrazol-5-amine;ethane;propane (PubChem CID 143843846) has the molecular formula C23H47N3 and a molecular weight of 365.65 g/mol. Its IUPAC name is 4-but-1-en-2-yl-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylpyrazol-5-amine;ethane;propane.
| Compound Name | 4-but-1-en-2-yl-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylpyrazol-5-amine;ethane;propane |
|---|---|
| PubChem CID | 143843846 |
| Molecular Formula | C23H47N3 |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.38 |
| IUPAC Name | 4-but-1-en-2-yl-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylpyrazol-5-amine;ethane;propane |
| SMILES | C=C(CC)c1cnn(C(/C=C\C)=C/C)c1NC.CC.CC.CC.CCC |
| InChI | InChI=1S/C14H21N3.C3H8.3C2H6/c1-6-9-12(8-3)17-14(15-5)13(10-16-17)11(4)7-2;1-3-2;3*1-2/h6,8-10,15H,4,7H2,1-3,5H3;3H2,1-2H3;3*1-2H3/b9-6-,12-8+;;;; |
| InChIKey | XAOLPTIIIVDNIA-DZBXRKGASA-N |
| XLogP | 8.28 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|