C11H17N5 — CID 143574863
N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide (PubChem CID 143574863) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 143574863 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N'-[(1Z)-3-[1-methyl-5-(methylamino)pyrazol-4-yl]buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C=C\N=C(/C)N)c1cnn(C)c1NC |
| InChI | InChI=1S/C11H17N5/c1-8(5-6-14-9(2)12)10-7-15-16(4)11(10)13-3/h5-7,13H,1H2,2-4H3,(H2,12,14)/b6-5- |
| InChIKey | WHJJXIDDJLIIOF-WAYWQWQTSA-N |
| XLogP | 1.37 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|